![2,3-Dihydrobenzo[1,4]dioxine-5-carbonyl chloride (CAS: 38871-41-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0685472.png "2,3-Dihydrobenzo[1,4]dioxine-5-carbonyl chloride chemical structure")
2,3-Dihydrobenzo[1,4]dioxine-5-carbonyl chloride
Catalog No: FT-0685472
CAS No: 38871-41-9
- Chemical Name: 2,3-Dihydrobenzo[1,4]dioxine-5-carbonyl chloride
- Molecular Formula: C9H7ClO3
- Molecular Weight: 198.60
- InChI Key: IEWVBBWTJOHHCY-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7ClO3/c10-9(11)6-2-1-3-7-8(6)13-5-4-12-7/h1-3H,4-5H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,3-Dihydrobenzo[1,4]dioxine-5-carbonyl chloride |
|---|---|
| Flash_Point: | 137.7ºC |
| Melting_Point: | 98ºC |
| FW: | 198.60300 |
| Density: | 1.371g/cm3 |
| CAS: | 38871-41-9 |
| Bolling_Point: | 305.2ºC at 760 mmHg |
| MF: | C9H7ClO3 |
| Density: | 1.371g/cm3 |
|---|---|
| LogP: | 1.83680 |
| Flash_Point: | 137.7ºC |
| Melting_Point: | 98ºC |
| FW: | 198.60300 |
| PSA: | 35.53000 |
| Exact_Mass: | 198.00800 |
| MF: | C9H7ClO3 |
| Bolling_Point: | 305.2ºC at 760 mmHg |
| Refractive_Index: | 1.566 |
| Hazard_Codes: | C:Corrosive |
|---|---|
| RIDADR: | UN 3261 |
| Risk_Statements(EU): | R34 |
| Safety_Statements: | S26-S36/37/39-S45 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)